C13H13F4N5O2 — CID 66615456
N'-[4-fluoro-3-(trifluoromethyl)phenyl]-4-(2-methoxyethylamino)-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 66615456) has the molecular formula C13H13F4N5O2 and a molecular weight of 347.27 g/mol. Its IUPAC name is N'-[4-fluoro-3-(trifluoromethyl)phenyl]-4-(2-methoxyethylamino)-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-[4-fluoro-3-(trifluoromethyl)phenyl]-4-(2-methoxyethylamino)-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 66615456 |
| Molecular Formula | C13H13F4N5O2 |
| Molecular Weight | 347.27 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | N'-[4-fluoro-3-(trifluoromethyl)phenyl]-4-(2-methoxyethylamino)-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | COCCNc1nonc1/C(N)=N/c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H13F4N5O2/c1-23-5-4-19-12-10(21-24-22-12)11(18)20-7-2-3-9(14)8(6-7)13(15,16)17/h2-3,6H,4-5H2,1H3,(H2,18,20)(H,19,22) |
| InChIKey | OYTWFDBBRMFSEW-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 98.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|