About 1-(2,5-dioxopyrrolidin-1-yl)-4-[[(2-iodoacetyl)amino]methyl]cyclohexane-1-carboxylic acid
1-(2,5-dioxopyrrolidin-1-yl)-4-[[(2-iodoacetyl)amino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 66615878) has the molecular formula C14H19IN2O5
and a molecular weight of 422.22 g/mol. Its IUPAC name is 1-(2,5-dioxopyrrolidin-1-yl)-4-[[(2-iodoacetyl)amino]methyl]cyclohexane-1-carboxylic acid.
Molecular Properties
| Compound Name | 1-(2,5-dioxopyrrolidin-1-yl)-4-[[(2-iodoacetyl)amino]methyl]cyclohexane-1-carboxylic acid |
| PubChem CID | 66615878 |
| Molecular Formula | C14H19IN2O5 |
| Molecular Weight | 422.22 g/mol |
| Exact Mass | 422.03 |
| IUPAC Name | 1-(2,5-dioxopyrrolidin-1-yl)-4-[[(2-iodoacetyl)amino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(CI)NCC1CCC(C(=O)O)(N2C(=O)CCC2=O)CC1 |
| InChI | InChI=1S/C14H19IN2O5/c15-7-10(18)16-8-9-3-5-14(6-4-9,13(21)22)17-11(19)1-2-12(17)20/h9H,1-8H2,(H,16,18)(H,21,22) |
| InChIKey | REMUISGGSZKZTD-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.22 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,5-dioxopyrrolidin-1-yl)-4-[[(2-iodoacetyl)amino]methyl]cyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,5-dioxopyrrolidin-1-yl)-4-[[(2-iodoacetyl)amino]methyl]cyclohexane-1-carboxylic acid?
The IUPAC name of 1-(2,5-dioxopyrrolidin-1-yl)-4-[[(2-iodoacetyl)amino]methyl]cyclohexane-1-carboxylic acid (CID 66615878) is 1-(2,5-dioxopyrrolidin-1-yl)-4-[[(2-iodoacetyl)amino]methyl]cyclohexane-1-carboxylic acid.
What is the SMILES notation for 1-(2,5-dioxopyrrolidin-1-yl)-4-[[(2-iodoacetyl)amino]methyl]cyclohexane-1-carboxylic acid?
The canonical SMILES for 1-(2,5-dioxopyrrolidin-1-yl)-4-[[(2-iodoacetyl)amino]methyl]cyclohexane-1-carboxylic acid is O=C(CI)NCC1CCC(C(=O)O)(N2C(=O)CCC2=O)CC1.
What is the InChIKey of 1-(2,5-dioxopyrrolidin-1-yl)-4-[[(2-iodoacetyl)amino]methyl]cyclohexane-1-carboxylic acid?
The InChIKey is REMUISGGSZKZTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19IN2O5/c15-7-10(18)16-8-9-3-5-14(6-4-9,13(21)22)17-11(19)1-2-12(17)20/h9H,1-8H2,(H,16,18)(H,21,22).
What are the key properties of 1-(2,5-dioxopyrrolidin-1-yl)-4-[[(2-iodoacetyl)amino]methyl]cyclohexane-1-carboxylic acid?
1-(2,5-dioxopyrrolidin-1-yl)-4-[[(2-iodoacetyl)amino]methyl]cyclohexane-1-carboxylic acid has a molecular weight of 422.22 g/mol, XLogP of 0.70, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,5-dioxopyrrolidin-1-yl)-4-[[(2-iodoacetyl)amino]methyl]cyclohexane-1-carboxylic acid is sourced from PubChem (CID 66615878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).