2-(2-phenylethyl)-1,3-thiazolidine-4-carboxylic acid

C12H15NO2S — CID 666161

IUPAC2-(2-phenylethyl)-1,3-thiazolidine-4-carboxylic acid
SMILESO=C(O)C1CSC(CCc2ccccc2)N1
InChIInChI=1S/C12H15NO2S/c14-12(15)10-8-16-11(13-10)7-6-9-4-2-1-3-5-9/h1-5,10-11,13H,6-8H2,(H,14,15)
InChIKeyOFMACPNNROAUSV-UHFFFAOYSA-N
MW237.32 g/mol
LogP1.73
Rot. Bonds4

About 2-(2-phenylethyl)-1,3-thiazolidine-4-carboxylic acid

2-(2-phenylethyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 666161) has the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. Its IUPAC name is 2-(2-phenylethyl)-1,3-thiazolidine-4-carboxylic acid.

Molecular Properties

Compound Name2-(2-phenylethyl)-1,3-thiazolidine-4-carboxylic acid
PubChem CID666161
Molecular FormulaC12H15NO2S
Molecular Weight237.32 g/mol
Exact Mass237.08
IUPAC Name2-(2-phenylethyl)-1,3-thiazolidine-4-carboxylic acid
SMILESO=C(O)C1CSC(CCc2ccccc2)N1
InChIInChI=1S/C12H15NO2S/c14-12(15)10-8-16-11(13-10)7-6-9-4-2-1-3-5-9/h1-5,10-11,13H,6-8H2,(H,14,15)
InChIKeyOFMACPNNROAUSV-UHFFFAOYSA-N
XLogP1.73
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500237.32
LogP ≤ 51.73
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-(2-phenylethyl)-1,3-thiazolidine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-phenylethyl)-1,3-thiazolidine-4-carboxylic acid?
The IUPAC name of 2-(2-phenylethyl)-1,3-thiazolidine-4-carboxylic acid (CID 666161) is 2-(2-phenylethyl)-1,3-thiazolidine-4-carboxylic acid.
What is the SMILES notation for 2-(2-phenylethyl)-1,3-thiazolidine-4-carboxylic acid?
The canonical SMILES for 2-(2-phenylethyl)-1,3-thiazolidine-4-carboxylic acid is O=C(O)C1CSC(CCc2ccccc2)N1.
What is the InChIKey of 2-(2-phenylethyl)-1,3-thiazolidine-4-carboxylic acid?
The InChIKey is OFMACPNNROAUSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO2S/c14-12(15)10-8-16-11(13-10)7-6-9-4-2-1-3-5-9/h1-5,10-11,13H,6-8H2,(H,14,15).
What are the key properties of 2-(2-phenylethyl)-1,3-thiazolidine-4-carboxylic acid?
2-(2-phenylethyl)-1,3-thiazolidine-4-carboxylic acid has a molecular weight of 237.32 g/mol, XLogP of 1.73, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-phenylethyl)-1,3-thiazolidine-4-carboxylic acid is sourced from PubChem (CID 666161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).