C31H28N2O5 — CID 66616311
6-(3,4-dimethoxyphenyl)-4-[4-(3,4,5-trimethoxyphenyl)phenyl]quinazoline (PubChem CID 66616311) has the molecular formula C31H28N2O5 and a molecular weight of 508.57 g/mol. Its IUPAC name is 6-(3,4-dimethoxyphenyl)-4-[4-(3,4,5-trimethoxyphenyl)phenyl]quinazoline.
| Compound Name | 6-(3,4-dimethoxyphenyl)-4-[4-(3,4,5-trimethoxyphenyl)phenyl]quinazoline |
|---|---|
| PubChem CID | 66616311 |
| Molecular Formula | C31H28N2O5 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | 6-(3,4-dimethoxyphenyl)-4-[4-(3,4,5-trimethoxyphenyl)phenyl]quinazoline |
| SMILES | COc1ccc(-c2ccc3ncnc(-c4ccc(-c5cc(OC)c(OC)c(OC)c5)cc4)c3c2)cc1OC |
| InChI | InChI=1S/C31H28N2O5/c1-34-26-13-11-22(15-27(26)35-2)21-10-12-25-24(14-21)30(33-18-32-25)20-8-6-19(7-9-20)23-16-28(36-3)31(38-5)29(17-23)37-4/h6-18H,1-5H3 |
| InChIKey | VTOFSKKOZSGHGH-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 71.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |