About (2-methylpyrimidin-5-yl) hydrogen carbonate
(2-methylpyrimidin-5-yl) hydrogen carbonate (PubChem CID 66616836) has the molecular formula C6H6N2O3
and a molecular weight of 154.12 g/mol. Its IUPAC name is (2-methylpyrimidin-5-yl) hydrogen carbonate.
Molecular Properties
| Compound Name | (2-methylpyrimidin-5-yl) hydrogen carbonate |
| PubChem CID | 66616836 |
| Molecular Formula | C6H6N2O3 |
| Molecular Weight | 154.12 g/mol |
| Exact Mass | 154.04 |
| IUPAC Name | (2-methylpyrimidin-5-yl) hydrogen carbonate |
| SMILES | Cc1ncc(OC(=O)O)cn1 |
| InChI | InChI=1S/C6H6N2O3/c1-4-7-2-5(3-8-4)11-6(9)10/h2-3H,1H3,(H,9,10) |
| InChIKey | HWBKTIPMXGUFIP-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.12 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-methylpyrimidin-5-yl) hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylpyrimidin-5-yl) hydrogen carbonate?
The IUPAC name of (2-methylpyrimidin-5-yl) hydrogen carbonate (CID 66616836) is (2-methylpyrimidin-5-yl) hydrogen carbonate.
What is the SMILES notation for (2-methylpyrimidin-5-yl) hydrogen carbonate?
The canonical SMILES for (2-methylpyrimidin-5-yl) hydrogen carbonate is Cc1ncc(OC(=O)O)cn1.
What is the InChIKey of (2-methylpyrimidin-5-yl) hydrogen carbonate?
The InChIKey is HWBKTIPMXGUFIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O3/c1-4-7-2-5(3-8-4)11-6(9)10/h2-3H,1H3,(H,9,10).
What are the key properties of (2-methylpyrimidin-5-yl) hydrogen carbonate?
(2-methylpyrimidin-5-yl) hydrogen carbonate has a molecular weight of 154.12 g/mol, XLogP of 0.84, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylpyrimidin-5-yl) hydrogen carbonate is sourced from PubChem (CID 66616836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).