About 2-prop-1-en-2-yl-4,5-dihydro-1,3-oxazole;styrene
2-prop-1-en-2-yl-4,5-dihydro-1,3-oxazole;styrene (PubChem CID 66616964) has the molecular formula C14H17NO
and a molecular weight of 215.30 g/mol. Its IUPAC name is 2-prop-1-en-2-yl-4,5-dihydro-1,3-oxazole;styrene.
Molecular Properties
| Compound Name | 2-prop-1-en-2-yl-4,5-dihydro-1,3-oxazole;styrene |
| PubChem CID | 66616964 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 2-prop-1-en-2-yl-4,5-dihydro-1,3-oxazole;styrene |
| SMILES | C=C(C)C1=NCCO1.C=Cc1ccccc1 |
| InChI | InChI=1S/C8H8.C6H9NO/c1-2-8-6-4-3-5-7-8;1-5(2)6-7-3-4-8-6/h2-7H,1H2;1,3-4H2,2H3 |
| InChIKey | CIZZWUZAQQELAQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-prop-1-en-2-yl-4,5-dihydro-1,3-oxazole;styrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-1-en-2-yl-4,5-dihydro-1,3-oxazole;styrene?
The IUPAC name of 2-prop-1-en-2-yl-4,5-dihydro-1,3-oxazole;styrene (CID 66616964) is 2-prop-1-en-2-yl-4,5-dihydro-1,3-oxazole;styrene.
What is the SMILES notation for 2-prop-1-en-2-yl-4,5-dihydro-1,3-oxazole;styrene?
The canonical SMILES for 2-prop-1-en-2-yl-4,5-dihydro-1,3-oxazole;styrene is C=C(C)C1=NCCO1.C=Cc1ccccc1.
What is the InChIKey of 2-prop-1-en-2-yl-4,5-dihydro-1,3-oxazole;styrene?
The InChIKey is CIZZWUZAQQELAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8.C6H9NO/c1-2-8-6-4-3-5-7-8;1-5(2)6-7-3-4-8-6/h2-7H,1H2;1,3-4H2,2H3.
What are the key properties of 2-prop-1-en-2-yl-4,5-dihydro-1,3-oxazole;styrene?
2-prop-1-en-2-yl-4,5-dihydro-1,3-oxazole;styrene has a molecular weight of 215.30 g/mol, XLogP of 3.32, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-1-en-2-yl-4,5-dihydro-1,3-oxazole;styrene is sourced from PubChem (CID 66616964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).