C20H19N3O4S2 — CID 66616997
3-[4-methoxy-1-[(3-methoxyphenyl)methyl]indazol-3-yl]thiophene-2-sulfonamide (PubChem CID 66616997) has the molecular formula C20H19N3O4S2 and a molecular weight of 429.52 g/mol. Its IUPAC name is 3-[4-methoxy-1-[(3-methoxyphenyl)methyl]indazol-3-yl]thiophene-2-sulfonamide.
| Compound Name | 3-[4-methoxy-1-[(3-methoxyphenyl)methyl]indazol-3-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 66616997 |
| Molecular Formula | C20H19N3O4S2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | 3-[4-methoxy-1-[(3-methoxyphenyl)methyl]indazol-3-yl]thiophene-2-sulfonamide |
| SMILES | COc1cccc(Cn2nc(-c3ccsc3S(N)(=O)=O)c3c(OC)cccc32)c1 |
| InChI | InChI=1S/C20H19N3O4S2/c1-26-14-6-3-5-13(11-14)12-23-16-7-4-8-17(27-2)18(16)19(22-23)15-9-10-28-20(15)29(21,24)25/h3-11H,12H2,1-2H3,(H2,21,24,25) |
| InChIKey | NRZAIMOLRQDQSO-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |