C11H18N2O2 — CID 66617082
1-ethenylpyrrolidin-2-one;2-methylbut-2-enamide (PubChem CID 66617082) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 1-ethenylpyrrolidin-2-one;2-methylbut-2-enamide.
| Compound Name | 1-ethenylpyrrolidin-2-one;2-methylbut-2-enamide |
|---|---|
| PubChem CID | 66617082 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 1-ethenylpyrrolidin-2-one;2-methylbut-2-enamide |
| SMILES | C=CN1CCCC1=O.CC=C(C)C(N)=O |
| InChI | InChI=1S/C6H9NO.C5H9NO/c1-2-7-5-3-4-6(7)8;1-3-4(2)5(6)7/h2H,1,3-5H2;3H,1-2H3,(H2,6,7) |
| InChIKey | ACCVYCBGPSWXRK-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|