C17H13NO4S2 — CID 66617178
2,5-bis(2,3-dihydrothieno[2,3-b][1,4]dioxin-7-yl)pyridine (PubChem CID 66617178) has the molecular formula C17H13NO4S2 and a molecular weight of 359.43 g/mol. Its IUPAC name is 2,5-bis(2,3-dihydrothieno[2,3-b][1,4]dioxin-7-yl)pyridine.
| Compound Name | 2,5-bis(2,3-dihydrothieno[2,3-b][1,4]dioxin-7-yl)pyridine |
|---|---|
| PubChem CID | 66617178 |
| Molecular Formula | C17H13NO4S2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | 2,5-bis(2,3-dihydrothieno[2,3-b][1,4]dioxin-7-yl)pyridine |
| SMILES | c1cc(-c2csc3c2OCCO3)ncc1-c1csc2c1OCCO2 |
| InChI | InChI=1S/C17H13NO4S2/c1-2-13(12-9-24-17-15(12)20-4-6-22-17)18-7-10(1)11-8-23-16-14(11)19-3-5-21-16/h1-2,7-9H,3-6H2 |
| InChIKey | IZCPQXAOTITREZ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |