About 3-propylidenecyclohexa-1,5-diene-1,4-dicarboxylic acid
3-propylidenecyclohexa-1,5-diene-1,4-dicarboxylic acid (PubChem CID 66617318) has the molecular formula C11H12O4
and a molecular weight of 208.21 g/mol. Its IUPAC name is 3-propylidenecyclohexa-1,5-diene-1,4-dicarboxylic acid.
Molecular Properties
| Compound Name | 3-propylidenecyclohexa-1,5-diene-1,4-dicarboxylic acid |
| PubChem CID | 66617318 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 3-propylidenecyclohexa-1,5-diene-1,4-dicarboxylic acid |
| SMILES | CCC=C1C=C(C(=O)O)C=CC1C(=O)O |
| InChI | InChI=1S/C11H12O4/c1-2-3-7-6-8(10(12)13)4-5-9(7)11(14)15/h3-6,9H,2H2,1H3,(H,12,13)(H,14,15) |
| InChIKey | QEVWLXQRSKMRIV-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-propylidenecyclohexa-1,5-diene-1,4-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propylidenecyclohexa-1,5-diene-1,4-dicarboxylic acid?
The IUPAC name of 3-propylidenecyclohexa-1,5-diene-1,4-dicarboxylic acid (CID 66617318) is 3-propylidenecyclohexa-1,5-diene-1,4-dicarboxylic acid.
What is the SMILES notation for 3-propylidenecyclohexa-1,5-diene-1,4-dicarboxylic acid?
The canonical SMILES for 3-propylidenecyclohexa-1,5-diene-1,4-dicarboxylic acid is CCC=C1C=C(C(=O)O)C=CC1C(=O)O.
What is the InChIKey of 3-propylidenecyclohexa-1,5-diene-1,4-dicarboxylic acid?
The InChIKey is QEVWLXQRSKMRIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O4/c1-2-3-7-6-8(10(12)13)4-5-9(7)11(14)15/h3-6,9H,2H2,1H3,(H,12,13)(H,14,15).
What are the key properties of 3-propylidenecyclohexa-1,5-diene-1,4-dicarboxylic acid?
3-propylidenecyclohexa-1,5-diene-1,4-dicarboxylic acid has a molecular weight of 208.21 g/mol, XLogP of 1.60, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propylidenecyclohexa-1,5-diene-1,4-dicarboxylic acid is sourced from PubChem (CID 66617318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).