C18H12N6OS — CID 66617405
6-methylsulfanyl-17-pyridin-2-yl-1,5,7,9,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-3,5,7,9,11,13,15-heptaen-2-one (PubChem CID 66617405) has the molecular formula C18H12N6OS and a molecular weight of 360.40 g/mol. Its IUPAC name is 6-methylsulfanyl-17-pyridin-2-yl-1,5,7,9,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-3,5,7,9,11,13,15-heptaen-2-one.
| Compound Name | 6-methylsulfanyl-17-pyridin-2-yl-1,5,7,9,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-3,5,7,9,11,13,15-heptaen-2-one |
|---|---|
| PubChem CID | 66617405 |
| Molecular Formula | C18H12N6OS |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 6-methylsulfanyl-17-pyridin-2-yl-1,5,7,9,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-3,5,7,9,11,13,15-heptaen-2-one |
| SMILES | CSc1ncc2c(=O)n3c(nc2n1)c1ccccc1n3-c1ccccn1 |
| InChI | InChI=1S/C18H12N6OS/c1-26-18-20-10-12-15(22-18)21-16-11-6-2-3-7-13(11)23(24(16)17(12)25)14-8-4-5-9-19-14/h2-10H,1H3 |
| InChIKey | SPIWCPNTFXPHNV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 77.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |