C16H10N6OS2 — CID 66617416
6-methylsulfanyl-17-(1,3-thiazol-4-yl)-1,5,7,9,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-3,5,7,9,11,13,15-heptaen-2-one (PubChem CID 66617416) has the molecular formula C16H10N6OS2 and a molecular weight of 366.43 g/mol. Its IUPAC name is 6-methylsulfanyl-17-(1,3-thiazol-4-yl)-1,5,7,9,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-3,5,7,9,11,13,15-heptaen-2-one.
| Compound Name | 6-methylsulfanyl-17-(1,3-thiazol-4-yl)-1,5,7,9,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-3,5,7,9,11,13,15-heptaen-2-one |
|---|---|
| PubChem CID | 66617416 |
| Molecular Formula | C16H10N6OS2 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | 6-methylsulfanyl-17-(1,3-thiazol-4-yl)-1,5,7,9,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-3,5,7,9,11,13,15-heptaen-2-one |
| SMILES | CSc1ncc2c(=O)n3c(nc2n1)c1ccccc1n3-c1cscn1 |
| InChI | InChI=1S/C16H10N6OS2/c1-24-16-17-6-10-13(20-16)19-14-9-4-2-3-5-11(9)21(22(14)15(10)23)12-7-25-8-18-12/h2-8H,1H3 |
| InChIKey | KWPMCJYWTMFROE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 77.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |