C13H17NO2 — CID 66617923
1,2,3,4,4a,5,5a,6-octahydrobenzo[g]quinoline-6,7-diol (PubChem CID 66617923) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 1,2,3,4,4a,5,5a,6-octahydrobenzo[g]quinoline-6,7-diol.
| Compound Name | 1,2,3,4,4a,5,5a,6-octahydrobenzo[g]quinoline-6,7-diol |
|---|---|
| PubChem CID | 66617923 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 1,2,3,4,4a,5,5a,6-octahydrobenzo[g]quinoline-6,7-diol |
| SMILES | OC1=CC=C2C=C3NCCCC3CC2C1O |
| InChI | InChI=1S/C13H17NO2/c15-12-4-3-8-7-11-9(2-1-5-14-11)6-10(8)13(12)16/h3-4,7,9-10,13-16H,1-2,5-6H2 |
| InChIKey | CJHAPGWOWCYVNE-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |