C16H24O2 — CID 66618224
4-(2,4-dimethylpyran-4-yl)-2,2,4,6-tetramethyl-3H-pyran (PubChem CID 66618224) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is 4-(2,4-dimethylpyran-4-yl)-2,2,4,6-tetramethyl-3H-pyran.
| Compound Name | 4-(2,4-dimethylpyran-4-yl)-2,2,4,6-tetramethyl-3H-pyran |
|---|---|
| PubChem CID | 66618224 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | 4-(2,4-dimethylpyran-4-yl)-2,2,4,6-tetramethyl-3H-pyran |
| SMILES | CC1=CC(C)(C2(C)C=C(C)OC(C)(C)C2)C=CO1 |
| InChI | InChI=1S/C16H24O2/c1-12-9-15(5,7-8-17-12)16(6)10-13(2)18-14(3,4)11-16/h7-10H,11H2,1-6H3 |
| InChIKey | VYCGUJXYGLXASW-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |