About adamantane;hydrochloride
adamantane;hydrochloride (PubChem CID 66618286) has the molecular formula C10H17Cl
and a molecular weight of 172.70 g/mol. Its IUPAC name is adamantane;hydrochloride.
Molecular Properties
| Compound Name | adamantane;hydrochloride |
| PubChem CID | 66618286 |
| Molecular Formula | C10H17Cl |
| Molecular Weight | 172.70 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | adamantane;hydrochloride |
| SMILES | C1C2CC3CC1CC(C2)C3.Cl |
| InChI | InChI=1S/C10H16.ClH/c1-7-2-9-4-8(1)5-10(3-7)6-9;/h7-10H,1-6H2;1H |
| InChIKey | UPWLURAENVJIJL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.70 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze adamantane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of adamantane;hydrochloride?
The IUPAC name of adamantane;hydrochloride (CID 66618286) is adamantane;hydrochloride.
What is the SMILES notation for adamantane;hydrochloride?
The canonical SMILES for adamantane;hydrochloride is C1C2CC3CC1CC(C2)C3.Cl.
What is the InChIKey of adamantane;hydrochloride?
The InChIKey is UPWLURAENVJIJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16.ClH/c1-7-2-9-4-8(1)5-10(3-7)6-9;/h7-10H,1-6H2;1H.
What are the key properties of adamantane;hydrochloride?
adamantane;hydrochloride has a molecular weight of 172.70 g/mol, XLogP of 3.25, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for adamantane;hydrochloride is sourced from PubChem (CID 66618286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).