C26H28N4OS — CID 66618304
N-(2,5-dimethylphenyl)-1-[4-[4-(5-phenyl-4,5-dihydro-1,2-oxazol-3-yl)-1,3-thiazol-2-yl]piperidin-1-yl]methanimine (PubChem CID 66618304) has the molecular formula C26H28N4OS and a molecular weight of 444.60 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-1-[4-[4-(5-phenyl-4,5-dihydro-1,2-oxazol-3-yl)-1,3-thiazol-2-yl]piperidin-1-yl]methanimine.
| Compound Name | N-(2,5-dimethylphenyl)-1-[4-[4-(5-phenyl-4,5-dihydro-1,2-oxazol-3-yl)-1,3-thiazol-2-yl]piperidin-1-yl]methanimine |
|---|---|
| PubChem CID | 66618304 |
| Molecular Formula | C26H28N4OS |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | N-(2,5-dimethylphenyl)-1-[4-[4-(5-phenyl-4,5-dihydro-1,2-oxazol-3-yl)-1,3-thiazol-2-yl]piperidin-1-yl]methanimine |
| SMILES | Cc1ccc(C)c(/N=C/N2CCC(c3nc(C4=NOC(c5ccccc5)C4)cs3)CC2)c1 |
| InChI | InChI=1S/C26H28N4OS/c1-18-8-9-19(2)22(14-18)27-17-30-12-10-21(11-13-30)26-28-24(16-32-26)23-15-25(31-29-23)20-6-4-3-5-7-20/h3-9,14,16-17,21,25H,10-13,15H2,1-2H3/b27-17+ |
| InChIKey | YTWZRFJESVKOIM-WPWMEQJKSA-N |
| XLogP | 6.17 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|