C23H20FN2O5S- — CID 66618871
5-[[5-(carboxymethoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]-sulfinatoamino]-2-(2-fluorophenyl)pyridine (PubChem CID 66618871) has the molecular formula C23H20FN2O5S- and a molecular weight of 455.49 g/mol. Its IUPAC name is 5-[[5-(carboxymethoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]-sulfinatoamino]-2-(2-fluorophenyl)pyridine.
| Compound Name | 5-[[5-(carboxymethoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]-sulfinatoamino]-2-(2-fluorophenyl)pyridine |
|---|---|
| PubChem CID | 66618871 |
| Molecular Formula | C23H20FN2O5S- |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | 5-[[5-(carboxymethoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]-sulfinatoamino]-2-(2-fluorophenyl)pyridine |
| SMILES | O=C(O)COc1cccc2c1CCCC2N(c1ccc(-c2ccccc2F)nc1)S(=O)[O-] |
| InChI | InChI=1S/C23H21FN2O5S/c24-19-8-2-1-5-18(19)20-12-11-15(13-25-20)26(32(29)30)21-9-3-7-17-16(21)6-4-10-22(17)31-14-23(27)28/h1-2,4-6,8,10-13,21H,3,7,9,14H2,(H,27,28)(H,29,30)/p-1 |
| InChIKey | DWZYRDRIQFORBH-UHFFFAOYSA-M |
| XLogP | 4.03 |
| TPSA | 102.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|