C14H13BrF3N3 — CID 66618886
2-bromo-8-methyl-7-[4-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 66618886) has the molecular formula C14H13BrF3N3 and a molecular weight of 360.18 g/mol. Its IUPAC name is 2-bromo-8-methyl-7-[4-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 2-bromo-8-methyl-7-[4-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 66618886 |
| Molecular Formula | C14H13BrF3N3 |
| Molecular Weight | 360.18 g/mol |
| Exact Mass | 359.02 |
| IUPAC Name | 2-bromo-8-methyl-7-[4-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | CC1c2nc(Br)nn2CCC1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H13BrF3N3/c1-8-11(6-7-21-12(8)19-13(15)20-21)9-2-4-10(5-3-9)14(16,17)18/h2-5,8,11H,6-7H2,1H3 |
| InChIKey | KRXWGOSJETVIRX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.18 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |