C10H22Cl2N2O2 — CID 66618898
4,5-bis(methoxymethyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;dihydrochloride (PubChem CID 66618898) has the molecular formula C10H22Cl2N2O2 and a molecular weight of 273.20 g/mol. Its IUPAC name is 4,5-bis(methoxymethyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;dihydrochloride.
| Compound Name | 4,5-bis(methoxymethyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;dihydrochloride |
|---|---|
| PubChem CID | 66618898 |
| Molecular Formula | C10H22Cl2N2O2 |
| Molecular Weight | 273.20 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 4,5-bis(methoxymethyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;dihydrochloride |
| SMILES | COCC1C2CNCC2CN1COC.Cl.Cl |
| InChI | InChI=1S/C10H20N2O2.2ClH/c1-13-6-10-9-4-11-3-8(9)5-12(10)7-14-2;;/h8-11H,3-7H2,1-2H3;2*1H |
| InChIKey | MEJDRSRXLSWDMN-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.20 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |