C23H19BrFN2O6S- — CID 66618997
3-bromo-5-[[5-(carboxymethoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]-sulfinatoamino]-2-(4-fluorophenoxy)pyridine (PubChem CID 66618997) has the molecular formula C23H19BrFN2O6S- and a molecular weight of 550.38 g/mol. Its IUPAC name is 3-bromo-5-[[5-(carboxymethoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]-sulfinatoamino]-2-(4-fluorophenoxy)pyridine.
| Compound Name | 3-bromo-5-[[5-(carboxymethoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]-sulfinatoamino]-2-(4-fluorophenoxy)pyridine |
|---|---|
| PubChem CID | 66618997 |
| Molecular Formula | C23H19BrFN2O6S- |
| Molecular Weight | 550.38 g/mol |
| Exact Mass | 549.01 |
| IUPAC Name | 3-bromo-5-[[5-(carboxymethoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]-sulfinatoamino]-2-(4-fluorophenoxy)pyridine |
| SMILES | O=C(O)COc1cccc2c1CCCC2N(c1cnc(Oc2ccc(F)cc2)c(Br)c1)S(=O)[O-] |
| InChI | InChI=1S/C23H20BrFN2O6S/c24-19-11-15(12-26-23(19)33-16-9-7-14(25)8-10-16)27(34(30)31)20-5-1-4-18-17(20)3-2-6-21(18)32-13-22(28)29/h2-3,6-12,20H,1,4-5,13H2,(H,28,29)(H,30,31)/p-1 |
| InChIKey | SSUSMWXQZJUPBJ-UHFFFAOYSA-M |
| XLogP | 4.92 |
| TPSA | 112.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.38 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|