About 1-hydroxybenzotriazole;bis(piperidine)
1-hydroxybenzotriazole;bis(piperidine) (PubChem CID 66619051) has the molecular formula C16H27N5O
and a molecular weight of 305.43 g/mol. Its IUPAC name is 1-hydroxybenzotriazole;bis(piperidine).
Molecular Properties
| Compound Name | 1-hydroxybenzotriazole;bis(piperidine) |
| PubChem CID | 66619051 |
| Molecular Formula | C16H27N5O |
| Molecular Weight | 305.43 g/mol |
| Exact Mass | 305.22 |
| IUPAC Name | 1-hydroxybenzotriazole;bis(piperidine) |
| SMILES | C1CCNCC1.C1CCNCC1.On1nnc2ccccc21 |
| InChI | InChI=1S/C6H5N3O.2C5H11N/c10-9-6-4-2-1-3-5(6)7-8-9;2*1-2-4-6-5-3-1/h1-4,10H;2*6H,1-5H2 |
| InChIKey | VIAUXFYJOFICQB-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 75.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxybenzotriazole;bis(piperidine) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxybenzotriazole;bis(piperidine)?
The IUPAC name of 1-hydroxybenzotriazole;bis(piperidine) (CID 66619051) is 1-hydroxybenzotriazole;bis(piperidine).
What is the SMILES notation for 1-hydroxybenzotriazole;bis(piperidine)?
The canonical SMILES for 1-hydroxybenzotriazole;bis(piperidine) is C1CCNCC1.C1CCNCC1.On1nnc2ccccc21.
What is the InChIKey of 1-hydroxybenzotriazole;bis(piperidine)?
The InChIKey is VIAUXFYJOFICQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3O.2C5H11N/c10-9-6-4-2-1-3-5(6)7-8-9;2*1-2-4-6-5-3-1/h1-4,10H;2*6H,1-5H2.
What are the key properties of 1-hydroxybenzotriazole;bis(piperidine)?
1-hydroxybenzotriazole;bis(piperidine) has a molecular weight of 305.43 g/mol, XLogP of 2.19, 0 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxybenzotriazole;bis(piperidine) is sourced from PubChem (CID 66619051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).