C12H15NO7 — CID 66619116
(2S)-1-[2-(4-methoxy-4-oxobut-2-enoyl)oxyacetyl]pyrrolidine-2-carboxylic acid (PubChem CID 66619116) has the molecular formula C12H15NO7 and a molecular weight of 285.25 g/mol. Its IUPAC name is (2S)-1-[2-(4-methoxy-4-oxobut-2-enoyl)oxyacetyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[2-(4-methoxy-4-oxobut-2-enoyl)oxyacetyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 66619116 |
| Molecular Formula | C12H15NO7 |
| Molecular Weight | 285.25 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | (2S)-1-[2-(4-methoxy-4-oxobut-2-enoyl)oxyacetyl]pyrrolidine-2-carboxylic acid |
| SMILES | COC(=O)C=CC(=O)OCC(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C12H15NO7/c1-19-10(15)4-5-11(16)20-7-9(14)13-6-2-3-8(13)12(17)18/h4-5,8H,2-3,6-7H2,1H3,(H,17,18)/t8-/m0/s1 |
| InChIKey | QGKOGAFKVNQUER-QMMMGPOBSA-N |
| XLogP | -0.67 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.25 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|