C32H33N5O4S — CID 66619129
N-(2-aminophenyl)-4-[4-[4-[6-(2-methoxyethoxy)-2-methylimidazo[1,2-a]pyridin-3-yl]-1,3-thiazol-2-yl]oxan-4-yl]benzamide (PubChem CID 66619129) has the molecular formula C32H33N5O4S and a molecular weight of 583.71 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[4-[4-[6-(2-methoxyethoxy)-2-methylimidazo[1,2-a]pyridin-3-yl]-1,3-thiazol-2-yl]oxan-4-yl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[4-[4-[6-(2-methoxyethoxy)-2-methylimidazo[1,2-a]pyridin-3-yl]-1,3-thiazol-2-yl]oxan-4-yl]benzamide |
|---|---|
| PubChem CID | 66619129 |
| Molecular Formula | C32H33N5O4S |
| Molecular Weight | 583.71 g/mol |
| Exact Mass | 583.23 |
| IUPAC Name | N-(2-aminophenyl)-4-[4-[4-[6-(2-methoxyethoxy)-2-methylimidazo[1,2-a]pyridin-3-yl]-1,3-thiazol-2-yl]oxan-4-yl]benzamide |
| SMILES | COCCOc1ccc2nc(C)c(-c3csc(C4(c5ccc(C(=O)Nc6ccccc6N)cc5)CCOCC4)n3)n2c1 |
| InChI | InChI=1S/C32H33N5O4S/c1-21-29(37-19-24(41-18-17-39-2)11-12-28(37)34-21)27-20-42-31(36-27)32(13-15-40-16-14-32)23-9-7-22(8-10-23)30(38)35-26-6-4-3-5-25(26)33/h3-12,19-20H,13-18,33H2,1-2H3,(H,35,38) |
| InChIKey | OPIYKLPOJSWRBK-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 113.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.71 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|