C17H20N2O3S — CID 666194
methyl 2-morpholin-4-yl-5-(thiophen-2-ylmethylamino)benzoate (PubChem CID 666194) has the molecular formula C17H20N2O3S and a molecular weight of 332.43 g/mol. Its IUPAC name is methyl 2-morpholin-4-yl-5-(thiophen-2-ylmethylamino)benzoate.
| Compound Name | methyl 2-morpholin-4-yl-5-(thiophen-2-ylmethylamino)benzoate |
|---|---|
| PubChem CID | 666194 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | methyl 2-morpholin-4-yl-5-(thiophen-2-ylmethylamino)benzoate |
| SMILES | COC(=O)c1cc(NCc2cccs2)ccc1N1CCOCC1 |
| InChI | InChI=1S/C17H20N2O3S/c1-21-17(20)15-11-13(18-12-14-3-2-10-23-14)4-5-16(15)19-6-8-22-9-7-19/h2-5,10-11,18H,6-9,12H2,1H3 |
| InChIKey | HSLSWLOVDVSQGB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|