About 4,4-dichloro-1H-pyrimidine
4,4-dichloro-1H-pyrimidine (PubChem CID 66619414) has the molecular formula C4H4Cl2N2
and a molecular weight of 151.00 g/mol. Its IUPAC name is 4,4-dichloro-1H-pyrimidine.
Molecular Properties
| Compound Name | 4,4-dichloro-1H-pyrimidine |
| PubChem CID | 66619414 |
| Molecular Formula | C4H4Cl2N2 |
| Molecular Weight | 151.00 g/mol |
| Exact Mass | 149.98 |
| IUPAC Name | 4,4-dichloro-1H-pyrimidine |
| SMILES | ClC1(Cl)C=CNC=N1 |
| InChI | InChI=1S/C4H4Cl2N2/c5-4(6)1-2-7-3-8-4/h1-3H,(H,7,8) |
| InChIKey | AWAQMCXENOQXCJ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.00 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 4,4-dichloro-1H-pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dichloro-1H-pyrimidine?
The IUPAC name of 4,4-dichloro-1H-pyrimidine (CID 66619414) is 4,4-dichloro-1H-pyrimidine.
What is the SMILES notation for 4,4-dichloro-1H-pyrimidine?
The canonical SMILES for 4,4-dichloro-1H-pyrimidine is ClC1(Cl)C=CNC=N1.
What is the InChIKey of 4,4-dichloro-1H-pyrimidine?
The InChIKey is AWAQMCXENOQXCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4Cl2N2/c5-4(6)1-2-7-3-8-4/h1-3H,(H,7,8).
What are the key properties of 4,4-dichloro-1H-pyrimidine?
4,4-dichloro-1H-pyrimidine has a molecular weight of 151.00 g/mol, XLogP of 1.26, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dichloro-1H-pyrimidine is sourced from PubChem (CID 66619414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).