C29H26FN5O2S — CID 66619432
N-(2-aminophenyl)-4-[4-[4-(8-fluoro-2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]oxan-4-yl]benzamide (PubChem CID 66619432) has the molecular formula C29H26FN5O2S and a molecular weight of 527.63 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[4-[4-(8-fluoro-2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]oxan-4-yl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[4-[4-(8-fluoro-2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]oxan-4-yl]benzamide |
|---|---|
| PubChem CID | 66619432 |
| Molecular Formula | C29H26FN5O2S |
| Molecular Weight | 527.63 g/mol |
| Exact Mass | 527.18 |
| IUPAC Name | N-(2-aminophenyl)-4-[4-[4-(8-fluoro-2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]oxan-4-yl]benzamide |
| SMILES | Cc1nc2c(F)cccn2c1-c1csc(C2(c3ccc(C(=O)Nc4ccccc4N)cc3)CCOCC2)n1 |
| InChI | InChI=1S/C29H26FN5O2S/c1-18-25(35-14-4-5-21(30)26(35)32-18)24-17-38-28(34-24)29(12-15-37-16-13-29)20-10-8-19(9-11-20)27(36)33-23-7-3-2-6-22(23)31/h2-11,14,17H,12-13,15-16,31H2,1H3,(H,33,36) |
| InChIKey | PFSLGQSFENORMM-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.63 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|