C19H15F3N4O2 — CID 66619964
N-[4-cyano-3-(trifluoromethyl)phenyl]-3-(2-hydroxyphenyl)-5-methyl-3,4-dihydropyrazole-5-carboxamide (PubChem CID 66619964) has the molecular formula C19H15F3N4O2 and a molecular weight of 388.35 g/mol. Its IUPAC name is N-[4-cyano-3-(trifluoromethyl)phenyl]-3-(2-hydroxyphenyl)-5-methyl-3,4-dihydropyrazole-5-carboxamide.
| Compound Name | N-[4-cyano-3-(trifluoromethyl)phenyl]-3-(2-hydroxyphenyl)-5-methyl-3,4-dihydropyrazole-5-carboxamide |
|---|---|
| PubChem CID | 66619964 |
| Molecular Formula | C19H15F3N4O2 |
| Molecular Weight | 388.35 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | N-[4-cyano-3-(trifluoromethyl)phenyl]-3-(2-hydroxyphenyl)-5-methyl-3,4-dihydropyrazole-5-carboxamide |
| SMILES | CC1(C(=O)Nc2ccc(C#N)c(C(F)(F)F)c2)CC(c2ccccc2O)N=N1 |
| InChI | InChI=1S/C19H15F3N4O2/c1-18(9-15(25-26-18)13-4-2-3-5-16(13)27)17(28)24-12-7-6-11(10-23)14(8-12)19(20,21)22/h2-8,15,27H,9H2,1H3,(H,24,28) |
| InChIKey | FULISVMTSGGZKQ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.35 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|