About tert-butyl 2-[5-(7-bromo-9,9-difluorofluoren-2-yl)-1H-imidazol-2-yl]pyrrolidine-1-carboxylate
tert-butyl 2-[5-(7-bromo-9,9-difluorofluoren-2-yl)-1H-imidazol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 66620561) has the molecular formula C25H24BrF2N3O2
and a molecular weight of 516.39 g/mol. Its IUPAC name is tert-butyl 2-[5-(7-bromo-9,9-difluorofluoren-2-yl)-1H-imidazol-2-yl]pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 2-[5-(7-bromo-9,9-difluorofluoren-2-yl)-1H-imidazol-2-yl]pyrrolidine-1-carboxylate |
| PubChem CID | 66620561 |
| Molecular Formula | C25H24BrF2N3O2 |
| Molecular Weight | 516.39 g/mol |
| Exact Mass | 515.10 |
| IUPAC Name | tert-butyl 2-[5-(7-bromo-9,9-difluorofluoren-2-yl)-1H-imidazol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1c1ncc(-c2ccc3c(c2)C(F)(F)c2cc(Br)ccc2-3)[nH]1 |
| InChI | InChI=1S/C25H24BrF2N3O2/c1-24(2,3)33-23(32)31-10-4-5-21(31)22-29-13-20(30-22)14-6-8-16-17-9-7-15(26)12-19(17)25(27,28)18(16)11-14/h6-9,11-13,21H,4-5,10H2,1-3H3,(H,29,30) |
| InChIKey | ZIIRQFQDDDKKSC-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 516.39 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl 2-[5-(7-bromo-9,9-difluorofluoren-2-yl)-1H-imidazol-2-yl]pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[5-(7-bromo-9,9-difluorofluoren-2-yl)-1H-imidazol-2-yl]pyrrolidine-1-carboxylate?
The IUPAC name of tert-butyl 2-[5-(7-bromo-9,9-difluorofluoren-2-yl)-1H-imidazol-2-yl]pyrrolidine-1-carboxylate (CID 66620561) is tert-butyl 2-[5-(7-bromo-9,9-difluorofluoren-2-yl)-1H-imidazol-2-yl]pyrrolidine-1-carboxylate.
What is the SMILES notation for tert-butyl 2-[5-(7-bromo-9,9-difluorofluoren-2-yl)-1H-imidazol-2-yl]pyrrolidine-1-carboxylate?
The canonical SMILES for tert-butyl 2-[5-(7-bromo-9,9-difluorofluoren-2-yl)-1H-imidazol-2-yl]pyrrolidine-1-carboxylate is CC(C)(C)OC(=O)N1CCCC1c1ncc(-c2ccc3c(c2)C(F)(F)c2cc(Br)ccc2-3)[nH]1.
What is the InChIKey of tert-butyl 2-[5-(7-bromo-9,9-difluorofluoren-2-yl)-1H-imidazol-2-yl]pyrrolidine-1-carboxylate?
The InChIKey is ZIIRQFQDDDKKSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H24BrF2N3O2/c1-24(2,3)33-23(32)31-10-4-5-21(31)22-29-13-20(30-22)14-6-8-16-17-9-7-15(26)12-19(17)25(27,28)18(16)11-14/h6-9,11-13,21H,4-5,10H2,1-3H3,(H,29,30).
What are the key properties of tert-butyl 2-[5-(7-bromo-9,9-difluorofluoren-2-yl)-1H-imidazol-2-yl]pyrrolidine-1-carboxylate?
tert-butyl 2-[5-(7-bromo-9,9-difluorofluoren-2-yl)-1H-imidazol-2-yl]pyrrolidine-1-carboxylate has a molecular weight of 516.39 g/mol, XLogP of 7.03, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[5-(7-bromo-9,9-difluorofluoren-2-yl)-1H-imidazol-2-yl]pyrrolidine-1-carboxylate is sourced from PubChem (CID 66620561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).