C25H36BN3O5 — CID 66620709
tert-butyl 2-[4-methyl-5-oxo-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 66620709) has the molecular formula C25H36BN3O5 and a molecular weight of 469.39 g/mol. Its IUPAC name is tert-butyl 2-[4-methyl-5-oxo-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[4-methyl-5-oxo-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 66620709 |
| Molecular Formula | C25H36BN3O5 |
| Molecular Weight | 469.39 g/mol |
| Exact Mass | 469.27 |
| IUPAC Name | tert-butyl 2-[4-methyl-5-oxo-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1C1=NC(C)(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)C(=O)N1 |
| InChI | InChI=1S/C25H36BN3O5/c1-22(2,3)32-21(31)29-15-9-10-18(29)19-27-20(30)25(8,28-19)16-11-13-17(14-12-16)26-33-23(4,5)24(6,7)34-26/h11-14,18H,9-10,15H2,1-8H3,(H,27,28,30) |
| InChIKey | DCLWARKNMCLSNE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|