About 2-O-[2-(6-bromonaphthalen-2-yl)-2-oxoethyl] 1-O-tert-butyl 4,4-difluoropyrrolidine-1,2-dicarboxylate
2-O-[2-(6-bromonaphthalen-2-yl)-2-oxoethyl] 1-O-tert-butyl 4,4-difluoropyrrolidine-1,2-dicarboxylate (PubChem CID 66620864) has the molecular formula C22H22BrF2NO5
and a molecular weight of 498.32 g/mol. Its IUPAC name is 2-O-[2-(6-bromonaphthalen-2-yl)-2-oxoethyl] 1-O-tert-butyl 4,4-difluoropyrrolidine-1,2-dicarboxylate.
Molecular Properties
| Compound Name | 2-O-[2-(6-bromonaphthalen-2-yl)-2-oxoethyl] 1-O-tert-butyl 4,4-difluoropyrrolidine-1,2-dicarboxylate |
| PubChem CID | 66620864 |
| Molecular Formula | C22H22BrF2NO5 |
| Molecular Weight | 498.32 g/mol |
| Exact Mass | 497.06 |
| IUPAC Name | 2-O-[2-(6-bromonaphthalen-2-yl)-2-oxoethyl] 1-O-tert-butyl 4,4-difluoropyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(F)(F)CC1C(=O)OCC(=O)c1ccc2cc(Br)ccc2c1 |
| InChI | InChI=1S/C22H22BrF2NO5/c1-21(2,3)31-20(29)26-12-22(24,25)10-17(26)19(28)30-11-18(27)15-5-4-14-9-16(23)7-6-13(14)8-15/h4-9,17H,10-12H2,1-3H3 |
| InChIKey | MYMDBDFZCKZBQE-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 498.32 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-O-[2-(6-bromonaphthalen-2-yl)-2-oxoethyl] 1-O-tert-butyl 4,4-difluoropyrrolidine-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-O-[2-(6-bromonaphthalen-2-yl)-2-oxoethyl] 1-O-tert-butyl 4,4-difluoropyrrolidine-1,2-dicarboxylate?
The IUPAC name of 2-O-[2-(6-bromonaphthalen-2-yl)-2-oxoethyl] 1-O-tert-butyl 4,4-difluoropyrrolidine-1,2-dicarboxylate (CID 66620864) is 2-O-[2-(6-bromonaphthalen-2-yl)-2-oxoethyl] 1-O-tert-butyl 4,4-difluoropyrrolidine-1,2-dicarboxylate.
What is the SMILES notation for 2-O-[2-(6-bromonaphthalen-2-yl)-2-oxoethyl] 1-O-tert-butyl 4,4-difluoropyrrolidine-1,2-dicarboxylate?
The canonical SMILES for 2-O-[2-(6-bromonaphthalen-2-yl)-2-oxoethyl] 1-O-tert-butyl 4,4-difluoropyrrolidine-1,2-dicarboxylate is CC(C)(C)OC(=O)N1CC(F)(F)CC1C(=O)OCC(=O)c1ccc2cc(Br)ccc2c1.
What is the InChIKey of 2-O-[2-(6-bromonaphthalen-2-yl)-2-oxoethyl] 1-O-tert-butyl 4,4-difluoropyrrolidine-1,2-dicarboxylate?
The InChIKey is MYMDBDFZCKZBQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22BrF2NO5/c1-21(2,3)31-20(29)26-12-22(24,25)10-17(26)19(28)30-11-18(27)15-5-4-14-9-16(23)7-6-13(14)8-15/h4-9,17H,10-12H2,1-3H3.
What are the key properties of 2-O-[2-(6-bromonaphthalen-2-yl)-2-oxoethyl] 1-O-tert-butyl 4,4-difluoropyrrolidine-1,2-dicarboxylate?
2-O-[2-(6-bromonaphthalen-2-yl)-2-oxoethyl] 1-O-tert-butyl 4,4-difluoropyrrolidine-1,2-dicarboxylate has a molecular weight of 498.32 g/mol, XLogP of 4.97, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-O-[2-(6-bromonaphthalen-2-yl)-2-oxoethyl] 1-O-tert-butyl 4,4-difluoropyrrolidine-1,2-dicarboxylate is sourced from PubChem (CID 66620864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).