C54H48O12 — CID 66621345
1,2,3,4,5,6-hexakis(4-methylphenyl)cyclohexane-1,2,3,4,5,6-hexacarboxylic acid (PubChem CID 66621345) has the molecular formula C54H48O12 and a molecular weight of 888.97 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexakis(4-methylphenyl)cyclohexane-1,2,3,4,5,6-hexacarboxylic acid.
| Compound Name | 1,2,3,4,5,6-hexakis(4-methylphenyl)cyclohexane-1,2,3,4,5,6-hexacarboxylic acid |
|---|---|
| PubChem CID | 66621345 |
| Molecular Formula | C54H48O12 |
| Molecular Weight | 888.97 g/mol |
| Exact Mass | 888.31 |
| IUPAC Name | 1,2,3,4,5,6-hexakis(4-methylphenyl)cyclohexane-1,2,3,4,5,6-hexacarboxylic acid |
| SMILES | Cc1ccc(C2(C(=O)O)C(C(=O)O)(c3ccc(C)cc3)C(C(=O)O)(c3ccc(C)cc3)C(C(=O)O)(c3ccc(C)cc3)C(C(=O)O)(c3ccc(C)cc3)C2(C(=O)O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C54H48O12/c1-31-7-19-37(20-8-31)49(43(55)56)50(44(57)58,38-21-9-32(2)10-22-38)52(46(61)62,40-25-13-34(4)14-26-40)54(48(65)66,42-29-17-36(6)18-30-42)53(47(63)64,41-27-15-35(5)16-28-41)51(49,45(59)60)39-23-11-33(3)12-24-39/h7-30H,1-6H3,(H,55,56)(H,57,58)(H,59,60)(H,61,62)(H,63,64)(H,65,66) |
| InChIKey | WUSBLRFPPNIHDQ-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 223.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 888.97 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |