C30H40BN3O6 — CID 66621418
methyl N-[3-methyl-1-oxo-1-[2-[[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]carbamoyl]pyrrolidin-1-yl]butan-2-yl]carbamate (PubChem CID 66621418) has the molecular formula C30H40BN3O6 and a molecular weight of 549.48 g/mol. Its IUPAC name is methyl N-[3-methyl-1-oxo-1-[2-[[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]carbamoyl]pyrrolidin-1-yl]butan-2-yl]carbamate.
| Compound Name | methyl N-[3-methyl-1-oxo-1-[2-[[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]carbamoyl]pyrrolidin-1-yl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 66621418 |
| Molecular Formula | C30H40BN3O6 |
| Molecular Weight | 549.48 g/mol |
| Exact Mass | 549.30 |
| IUPAC Name | methyl N-[3-methyl-1-oxo-1-[2-[[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]carbamoyl]pyrrolidin-1-yl]butan-2-yl]carbamate |
| SMILES | COC(=O)NC(C(=O)N1CCCC1C(=O)Nc1ccc(-c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)cc1)C(C)C |
| InChI | InChI=1S/C30H40BN3O6/c1-19(2)25(33-28(37)38-7)27(36)34-18-8-9-24(34)26(35)32-23-16-12-21(13-17-23)20-10-14-22(15-11-20)31-39-29(3,4)30(5,6)40-31/h10-17,19,24-25H,8-9,18H2,1-7H3,(H,32,35)(H,33,37) |
| InChIKey | WPCPJMINPDIMBU-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|