About azane;benzene-1,2-diol;ethene
azane;benzene-1,2-diol;ethene (PubChem CID 66622051) has the molecular formula C8H16N2O2
and a molecular weight of 172.23 g/mol. Its IUPAC name is azane;benzene-1,2-diol;ethene.
Molecular Properties
| Compound Name | azane;benzene-1,2-diol;ethene |
| PubChem CID | 66622051 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | azane;benzene-1,2-diol;ethene |
| SMILES | C=C.N.N.Oc1ccccc1O |
| InChI | InChI=1S/C6H6O2.C2H4.2H3N/c7-5-3-1-2-4-6(5)8;1-2;;/h1-4,7-8H;1-2H2;2*1H3 |
| InChIKey | ZKNMSXQKEBKCAG-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze azane;benzene-1,2-diol;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;benzene-1,2-diol;ethene?
The IUPAC name of azane;benzene-1,2-diol;ethene (CID 66622051) is azane;benzene-1,2-diol;ethene.
What is the SMILES notation for azane;benzene-1,2-diol;ethene?
The canonical SMILES for azane;benzene-1,2-diol;ethene is C=C.N.N.Oc1ccccc1O.
What is the InChIKey of azane;benzene-1,2-diol;ethene?
The InChIKey is ZKNMSXQKEBKCAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O2.C2H4.2H3N/c7-5-3-1-2-4-6(5)8;1-2;;/h1-4,7-8H;1-2H2;2*1H3.
What are the key properties of azane;benzene-1,2-diol;ethene?
azane;benzene-1,2-diol;ethene has a molecular weight of 172.23 g/mol, XLogP of 2.22, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;benzene-1,2-diol;ethene is sourced from PubChem (CID 66622051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).