About tert-butyl N-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-hydroxy-1-methoxypropan-2-yl]-N-methylcarbamate
tert-butyl N-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-hydroxy-1-methoxypropan-2-yl]-N-methylcarbamate (PubChem CID 66622301) has the molecular formula C15H29NO6
and a molecular weight of 319.40 g/mol. Its IUPAC name is tert-butyl N-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-hydroxy-1-methoxypropan-2-yl]-N-methylcarbamate.
Molecular Properties
| Compound Name | tert-butyl N-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-hydroxy-1-methoxypropan-2-yl]-N-methylcarbamate |
| PubChem CID | 66622301 |
| Molecular Formula | C15H29NO6 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | tert-butyl N-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-hydroxy-1-methoxypropan-2-yl]-N-methylcarbamate |
| SMILES | COC(C1COC(C)(C)O1)C(CO)N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H29NO6/c1-14(2,3)22-13(18)16(6)10(8-17)12(19-7)11-9-20-15(4,5)21-11/h10-12,17H,8-9H2,1-7H3 |
| InChIKey | IVUKZFCZTFDTMC-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl N-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-hydroxy-1-methoxypropan-2-yl]-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-hydroxy-1-methoxypropan-2-yl]-N-methylcarbamate?
The IUPAC name of tert-butyl N-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-hydroxy-1-methoxypropan-2-yl]-N-methylcarbamate (CID 66622301) is tert-butyl N-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-hydroxy-1-methoxypropan-2-yl]-N-methylcarbamate.
What is the SMILES notation for tert-butyl N-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-hydroxy-1-methoxypropan-2-yl]-N-methylcarbamate?
The canonical SMILES for tert-butyl N-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-hydroxy-1-methoxypropan-2-yl]-N-methylcarbamate is COC(C1COC(C)(C)O1)C(CO)N(C)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-hydroxy-1-methoxypropan-2-yl]-N-methylcarbamate?
The InChIKey is IVUKZFCZTFDTMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29NO6/c1-14(2,3)22-13(18)16(6)10(8-17)12(19-7)11-9-20-15(4,5)21-11/h10-12,17H,8-9H2,1-7H3.
What are the key properties of tert-butyl N-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-hydroxy-1-methoxypropan-2-yl]-N-methylcarbamate?
tert-butyl N-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-hydroxy-1-methoxypropan-2-yl]-N-methylcarbamate has a molecular weight of 319.40 g/mol, XLogP of 1.38, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-hydroxy-1-methoxypropan-2-yl]-N-methylcarbamate is sourced from PubChem (CID 66622301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).