C34H26BrNO6S — CID 6662284
(3aS,6R,11aS,11bR)-9-bromo-6-(2-hydroxy-4-phenylmethoxyphenyl)-2-(thiophen-2-ylmethyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 6662284) has the molecular formula C34H26BrNO6S and a molecular weight of 656.55 g/mol. Its IUPAC name is (3aS,6R,11aS,11bR)-9-bromo-6-(2-hydroxy-4-phenylmethoxyphenyl)-2-(thiophen-2-ylmethyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | (3aS,6R,11aS,11bR)-9-bromo-6-(2-hydroxy-4-phenylmethoxyphenyl)-2-(thiophen-2-ylmethyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 6662284 |
| Molecular Formula | C34H26BrNO6S |
| Molecular Weight | 656.55 g/mol |
| Exact Mass | 655.07 |
| IUPAC Name | (3aS,6R,11aS,11bR)-9-bromo-6-(2-hydroxy-4-phenylmethoxyphenyl)-2-(thiophen-2-ylmethyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | O=C1C=C(Br)C(=O)C2=C1[C@@H](c1ccc(OCc3ccccc3)cc1O)C1=CC[C@@H]3C(=O)N(Cc4cccs4)C(=O)[C@@H]3[C@@H]1C2 |
| InChI | InChI=1S/C34H26BrNO6S/c35-26-15-28(38)31-25(32(26)39)14-24-21(10-11-23-30(24)34(41)36(33(23)40)16-20-7-4-12-43-20)29(31)22-9-8-19(13-27(22)37)42-17-18-5-2-1-3-6-18/h1-10,12-13,15,23-24,29-30,37H,11,14,16-17H2/t23-,24+,29+,30-/m0/s1 |
| InChIKey | XWYPCOBIJXFPQV-JPBZRQQJSA-N |
| XLogP | 5.99 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.55 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|