C13H13N2O3P — CID 666229
N-(3-oxo-2,4-dihydro-1,5,3lambda5-benzodioxaphosphepin-3-yl)pyridin-3-amine (PubChem CID 666229) has the molecular formula C13H13N2O3P and a molecular weight of 276.23 g/mol. Its IUPAC name is N-(3-oxo-2,4-dihydro-1,5,3lambda5-benzodioxaphosphepin-3-yl)pyridin-3-amine.
| Compound Name | N-(3-oxo-2,4-dihydro-1,5,3lambda5-benzodioxaphosphepin-3-yl)pyridin-3-amine |
|---|---|
| PubChem CID | 666229 |
| Molecular Formula | C13H13N2O3P |
| Molecular Weight | 276.23 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | N-(3-oxo-2,4-dihydro-1,5,3lambda5-benzodioxaphosphepin-3-yl)pyridin-3-amine |
| SMILES | O=P1(Nc2cccnc2)COc2ccccc2OC1 |
| InChI | InChI=1S/C13H13N2O3P/c16-19(15-11-4-3-7-14-8-11)9-17-12-5-1-2-6-13(12)18-10-19/h1-8H,9-10H2,(H,15,16) |
| InChIKey | OYHIMEKCPNTFLJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.23 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|