About (3-phenyl-1,2-oxazol-5-yl)methyl quinoline-2-carboxylate
(3-phenyl-1,2-oxazol-5-yl)methyl quinoline-2-carboxylate (PubChem CID 666233) has the molecular formula C20H14N2O3
and a molecular weight of 330.34 g/mol. Its IUPAC name is (3-phenyl-1,2-oxazol-5-yl)methyl quinoline-2-carboxylate.
Molecular Properties
| Compound Name | (3-phenyl-1,2-oxazol-5-yl)methyl quinoline-2-carboxylate |
| PubChem CID | 666233 |
| Molecular Formula | C20H14N2O3 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | (3-phenyl-1,2-oxazol-5-yl)methyl quinoline-2-carboxylate |
| SMILES | O=C(OCc1cc(-c2ccccc2)no1)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C20H14N2O3/c23-20(18-11-10-15-8-4-5-9-17(15)21-18)24-13-16-12-19(22-25-16)14-6-2-1-3-7-14/h1-12H,13H2 |
| InChIKey | MGSHLXFZOSPXKQ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3-phenyl-1,2-oxazol-5-yl)methyl quinoline-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-phenyl-1,2-oxazol-5-yl)methyl quinoline-2-carboxylate?
The IUPAC name of (3-phenyl-1,2-oxazol-5-yl)methyl quinoline-2-carboxylate (CID 666233) is (3-phenyl-1,2-oxazol-5-yl)methyl quinoline-2-carboxylate.
What is the SMILES notation for (3-phenyl-1,2-oxazol-5-yl)methyl quinoline-2-carboxylate?
The canonical SMILES for (3-phenyl-1,2-oxazol-5-yl)methyl quinoline-2-carboxylate is O=C(OCc1cc(-c2ccccc2)no1)c1ccc2ccccc2n1.
What is the InChIKey of (3-phenyl-1,2-oxazol-5-yl)methyl quinoline-2-carboxylate?
The InChIKey is MGSHLXFZOSPXKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14N2O3/c23-20(18-11-10-15-8-4-5-9-17(15)21-18)24-13-16-12-19(22-25-16)14-6-2-1-3-7-14/h1-12H,13H2.
What are the key properties of (3-phenyl-1,2-oxazol-5-yl)methyl quinoline-2-carboxylate?
(3-phenyl-1,2-oxazol-5-yl)methyl quinoline-2-carboxylate has a molecular weight of 330.34 g/mol, XLogP of 4.25, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-phenyl-1,2-oxazol-5-yl)methyl quinoline-2-carboxylate is sourced from PubChem (CID 666233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).