About [4-[2-[1-(3-methylbutyl)pyrazol-4-yl]imidazo[1,2-a]pyridin-6-yl]-1,3-thiazol-2-yl]methanol
[4-[2-[1-(3-methylbutyl)pyrazol-4-yl]imidazo[1,2-a]pyridin-6-yl]-1,3-thiazol-2-yl]methanol (PubChem CID 66623798) has the molecular formula C19H21N5OS
and a molecular weight of 367.48 g/mol. Its IUPAC name is [4-[2-[1-(3-methylbutyl)pyrazol-4-yl]imidazo[1,2-a]pyridin-6-yl]-1,3-thiazol-2-yl]methanol.
Molecular Properties
| Compound Name | [4-[2-[1-(3-methylbutyl)pyrazol-4-yl]imidazo[1,2-a]pyridin-6-yl]-1,3-thiazol-2-yl]methanol |
| PubChem CID | 66623798 |
| Molecular Formula | C19H21N5OS |
| Molecular Weight | 367.48 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | [4-[2-[1-(3-methylbutyl)pyrazol-4-yl]imidazo[1,2-a]pyridin-6-yl]-1,3-thiazol-2-yl]methanol |
| SMILES | CC(C)CCn1cc(-c2cn3cc(-c4csc(CO)n4)ccc3n2)cn1 |
| InChI | InChI=1S/C19H21N5OS/c1-13(2)5-6-24-9-15(7-20-24)16-10-23-8-14(3-4-18(23)21-16)17-12-26-19(11-25)22-17/h3-4,7-10,12-13,25H,5-6,11H2,1-2H3 |
| InChIKey | HGQIUMKXTCAPOB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 68.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.48 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [4-[2-[1-(3-methylbutyl)pyrazol-4-yl]imidazo[1,2-a]pyridin-6-yl]-1,3-thiazol-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-[1-(3-methylbutyl)pyrazol-4-yl]imidazo[1,2-a]pyridin-6-yl]-1,3-thiazol-2-yl]methanol?
The IUPAC name of [4-[2-[1-(3-methylbutyl)pyrazol-4-yl]imidazo[1,2-a]pyridin-6-yl]-1,3-thiazol-2-yl]methanol (CID 66623798) is [4-[2-[1-(3-methylbutyl)pyrazol-4-yl]imidazo[1,2-a]pyridin-6-yl]-1,3-thiazol-2-yl]methanol.
What is the SMILES notation for [4-[2-[1-(3-methylbutyl)pyrazol-4-yl]imidazo[1,2-a]pyridin-6-yl]-1,3-thiazol-2-yl]methanol?
The canonical SMILES for [4-[2-[1-(3-methylbutyl)pyrazol-4-yl]imidazo[1,2-a]pyridin-6-yl]-1,3-thiazol-2-yl]methanol is CC(C)CCn1cc(-c2cn3cc(-c4csc(CO)n4)ccc3n2)cn1.
What is the InChIKey of [4-[2-[1-(3-methylbutyl)pyrazol-4-yl]imidazo[1,2-a]pyridin-6-yl]-1,3-thiazol-2-yl]methanol?
The InChIKey is HGQIUMKXTCAPOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N5OS/c1-13(2)5-6-24-9-15(7-20-24)16-10-23-8-14(3-4-18(23)21-16)17-12-26-19(11-25)22-17/h3-4,7-10,12-13,25H,5-6,11H2,1-2H3.
What are the key properties of [4-[2-[1-(3-methylbutyl)pyrazol-4-yl]imidazo[1,2-a]pyridin-6-yl]-1,3-thiazol-2-yl]methanol?
[4-[2-[1-(3-methylbutyl)pyrazol-4-yl]imidazo[1,2-a]pyridin-6-yl]-1,3-thiazol-2-yl]methanol has a molecular weight of 367.48 g/mol, XLogP of 3.86, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-[1-(3-methylbutyl)pyrazol-4-yl]imidazo[1,2-a]pyridin-6-yl]-1,3-thiazol-2-yl]methanol is sourced from PubChem (CID 66623798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).