About [(1S)-1-(5-fluoropyrimidin-2-yl)-3,3-dimethylbutyl]carbamic acid
[(1S)-1-(5-fluoropyrimidin-2-yl)-3,3-dimethylbutyl]carbamic acid (PubChem CID 66623931) has the molecular formula C11H16FN3O2
and a molecular weight of 241.27 g/mol. Its IUPAC name is [(1S)-1-(5-fluoropyrimidin-2-yl)-3,3-dimethylbutyl]carbamic acid.
Molecular Properties
| Compound Name | [(1S)-1-(5-fluoropyrimidin-2-yl)-3,3-dimethylbutyl]carbamic acid |
| PubChem CID | 66623931 |
| Molecular Formula | C11H16FN3O2 |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | [(1S)-1-(5-fluoropyrimidin-2-yl)-3,3-dimethylbutyl]carbamic acid |
| SMILES | CC(C)(C)C[C@H](NC(=O)O)c1ncc(F)cn1 |
| InChI | InChI=1S/C11H16FN3O2/c1-11(2,3)4-8(15-10(16)17)9-13-5-7(12)6-14-9/h5-6,8,15H,4H2,1-3H3,(H,16,17)/t8-/m0/s1 |
| InChIKey | ABTFRMHOINMIOU-QMMMGPOBSA-N |
| XLogP | 2.36 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(1S)-1-(5-fluoropyrimidin-2-yl)-3,3-dimethylbutyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-(5-fluoropyrimidin-2-yl)-3,3-dimethylbutyl]carbamic acid?
The IUPAC name of [(1S)-1-(5-fluoropyrimidin-2-yl)-3,3-dimethylbutyl]carbamic acid (CID 66623931) is [(1S)-1-(5-fluoropyrimidin-2-yl)-3,3-dimethylbutyl]carbamic acid.
What is the SMILES notation for [(1S)-1-(5-fluoropyrimidin-2-yl)-3,3-dimethylbutyl]carbamic acid?
The canonical SMILES for [(1S)-1-(5-fluoropyrimidin-2-yl)-3,3-dimethylbutyl]carbamic acid is CC(C)(C)C[C@H](NC(=O)O)c1ncc(F)cn1.
What is the InChIKey of [(1S)-1-(5-fluoropyrimidin-2-yl)-3,3-dimethylbutyl]carbamic acid?
The InChIKey is ABTFRMHOINMIOU-QMMMGPOBSA-N. The full InChI is InChI=1S/C11H16FN3O2/c1-11(2,3)4-8(15-10(16)17)9-13-5-7(12)6-14-9/h5-6,8,15H,4H2,1-3H3,(H,16,17)/t8-/m0/s1.
What are the key properties of [(1S)-1-(5-fluoropyrimidin-2-yl)-3,3-dimethylbutyl]carbamic acid?
[(1S)-1-(5-fluoropyrimidin-2-yl)-3,3-dimethylbutyl]carbamic acid has a molecular weight of 241.27 g/mol, XLogP of 2.36, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-(5-fluoropyrimidin-2-yl)-3,3-dimethylbutyl]carbamic acid is sourced from PubChem (CID 66623931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).