About thieno[3,2-d]triazine
thieno[3,2-d]triazine (PubChem CID 66624199) has the molecular formula C5H3N3S
and a molecular weight of 137.17 g/mol. Its IUPAC name is thieno[3,2-d]triazine.
Molecular Properties
| Compound Name | thieno[3,2-d]triazine |
| PubChem CID | 66624199 |
| Molecular Formula | C5H3N3S |
| Molecular Weight | 137.17 g/mol |
| Exact Mass | 137.00 |
| IUPAC Name | thieno[3,2-d]triazine |
| SMILES | c1cc2nnncc2s1 |
| InChI | InChI=1S/C5H3N3S/c1-2-9-5-3-6-8-7-4(1)5/h1-3H |
| InChIKey | DDXXAXFVICOMLN-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.17 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze thieno[3,2-d]triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thieno[3,2-d]triazine?
The IUPAC name of thieno[3,2-d]triazine (CID 66624199) is thieno[3,2-d]triazine.
What is the SMILES notation for thieno[3,2-d]triazine?
The canonical SMILES for thieno[3,2-d]triazine is c1cc2nnncc2s1.
What is the InChIKey of thieno[3,2-d]triazine?
The InChIKey is DDXXAXFVICOMLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3N3S/c1-2-9-5-3-6-8-7-4(1)5/h1-3H.
What are the key properties of thieno[3,2-d]triazine?
thieno[3,2-d]triazine has a molecular weight of 137.17 g/mol, XLogP of 1.09, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for thieno[3,2-d]triazine is sourced from PubChem (CID 66624199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).