About pyrazolo[4,3-c]pyrazole
pyrazolo[4,3-c]pyrazole (PubChem CID 66624235) has the molecular formula C4H2N4
and a molecular weight of 106.09 g/mol. Its IUPAC name is pyrazolo[4,3-c]pyrazole.
Molecular Properties
| Compound Name | pyrazolo[4,3-c]pyrazole |
| PubChem CID | 66624235 |
| Molecular Formula | C4H2N4 |
| Molecular Weight | 106.09 g/mol |
| Exact Mass | 106.03 |
| IUPAC Name | pyrazolo[4,3-c]pyrazole |
| SMILES | C1=C2N=NC=C2N=N1 |
| InChI | InChI=1S/C4H2N4/c1-3-4(8-5-1)2-6-7-3/h1-2H |
| InChIKey | VNAUDIIOSMNXBA-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.09 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pyrazolo[4,3-c]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrazolo[4,3-c]pyrazole?
The IUPAC name of pyrazolo[4,3-c]pyrazole (CID 66624235) is pyrazolo[4,3-c]pyrazole.
What is the SMILES notation for pyrazolo[4,3-c]pyrazole?
The canonical SMILES for pyrazolo[4,3-c]pyrazole is C1=C2N=NC=C2N=N1.
What is the InChIKey of pyrazolo[4,3-c]pyrazole?
The InChIKey is VNAUDIIOSMNXBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2N4/c1-3-4(8-5-1)2-6-7-3/h1-2H.
What are the key properties of pyrazolo[4,3-c]pyrazole?
pyrazolo[4,3-c]pyrazole has a molecular weight of 106.09 g/mol, XLogP of 1.60, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrazolo[4,3-c]pyrazole is sourced from PubChem (CID 66624235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).