About 9-[(2R)-butan-2-yl]-2-methyl-4,5-dihydropurin-6-amine
9-[(2R)-butan-2-yl]-2-methyl-4,5-dihydropurin-6-amine (PubChem CID 66624303) has the molecular formula C10H17N5
and a molecular weight of 207.28 g/mol. Its IUPAC name is 9-[(2R)-butan-2-yl]-2-methyl-4,5-dihydropurin-6-amine.
Molecular Properties
| Compound Name | 9-[(2R)-butan-2-yl]-2-methyl-4,5-dihydropurin-6-amine |
| PubChem CID | 66624303 |
| Molecular Formula | C10H17N5 |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.15 |
| IUPAC Name | 9-[(2R)-butan-2-yl]-2-methyl-4,5-dihydropurin-6-amine |
| SMILES | CC[C@@H](C)N1C=NC2C(N)=NC(C)=NC21 |
| InChI | InChI=1S/C10H17N5/c1-4-6(2)15-5-12-8-9(11)13-7(3)14-10(8)15/h5-6,8,10H,4H2,1-3H3,(H2,11,13,14)/t6-,8?,10?/m1/s1 |
| InChIKey | BTIKRCHVBGWXAD-CACVWYNPSA-N |
| XLogP | 0.61 |
| TPSA | 66.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 9-[(2R)-butan-2-yl]-2-methyl-4,5-dihydropurin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[(2R)-butan-2-yl]-2-methyl-4,5-dihydropurin-6-amine?
The IUPAC name of 9-[(2R)-butan-2-yl]-2-methyl-4,5-dihydropurin-6-amine (CID 66624303) is 9-[(2R)-butan-2-yl]-2-methyl-4,5-dihydropurin-6-amine.
What is the SMILES notation for 9-[(2R)-butan-2-yl]-2-methyl-4,5-dihydropurin-6-amine?
The canonical SMILES for 9-[(2R)-butan-2-yl]-2-methyl-4,5-dihydropurin-6-amine is CC[C@@H](C)N1C=NC2C(N)=NC(C)=NC21.
What is the InChIKey of 9-[(2R)-butan-2-yl]-2-methyl-4,5-dihydropurin-6-amine?
The InChIKey is BTIKRCHVBGWXAD-CACVWYNPSA-N. The full InChI is InChI=1S/C10H17N5/c1-4-6(2)15-5-12-8-9(11)13-7(3)14-10(8)15/h5-6,8,10H,4H2,1-3H3,(H2,11,13,14)/t6-,8?,10?/m1/s1.
What are the key properties of 9-[(2R)-butan-2-yl]-2-methyl-4,5-dihydropurin-6-amine?
9-[(2R)-butan-2-yl]-2-methyl-4,5-dihydropurin-6-amine has a molecular weight of 207.28 g/mol, XLogP of 0.61, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[(2R)-butan-2-yl]-2-methyl-4,5-dihydropurin-6-amine is sourced from PubChem (CID 66624303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).