About [1,4]dioxino[2,3-c]pyridazine
[1,4]dioxino[2,3-c]pyridazine (PubChem CID 66624407) has the molecular formula C6H4N2O2
and a molecular weight of 136.11 g/mol. Its IUPAC name is [1,4]dioxino[2,3-c]pyridazine.
Molecular Properties
| Compound Name | [1,4]dioxino[2,3-c]pyridazine |
| PubChem CID | 66624407 |
| Molecular Formula | C6H4N2O2 |
| Molecular Weight | 136.11 g/mol |
| Exact Mass | 136.03 |
| IUPAC Name | [1,4]dioxino[2,3-c]pyridazine |
| SMILES | C1=COc2nnccc2O1 |
| InChI | InChI=1S/C6H4N2O2/c1-2-7-8-6-5(1)9-3-4-10-6/h1-4H |
| InChIKey | JQTQOMCOCLBKTG-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.11 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1,4]dioxino[2,3-c]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,4]dioxino[2,3-c]pyridazine?
The IUPAC name of [1,4]dioxino[2,3-c]pyridazine (CID 66624407) is [1,4]dioxino[2,3-c]pyridazine.
What is the SMILES notation for [1,4]dioxino[2,3-c]pyridazine?
The canonical SMILES for [1,4]dioxino[2,3-c]pyridazine is C1=COc2nnccc2O1.
What is the InChIKey of [1,4]dioxino[2,3-c]pyridazine?
The InChIKey is JQTQOMCOCLBKTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2O2/c1-2-7-8-6-5(1)9-3-4-10-6/h1-4H.
What are the key properties of [1,4]dioxino[2,3-c]pyridazine?
[1,4]dioxino[2,3-c]pyridazine has a molecular weight of 136.11 g/mol, XLogP of 0.72, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1,4]dioxino[2,3-c]pyridazine is sourced from PubChem (CID 66624407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).