About [4-[2-(1,3-thiazol-2-yl)imidazo[1,2-a]pyridin-6-yl]thiophen-2-yl]methanol
[4-[2-(1,3-thiazol-2-yl)imidazo[1,2-a]pyridin-6-yl]thiophen-2-yl]methanol (PubChem CID 66624721) has the molecular formula C15H11N3OS2
and a molecular weight of 313.41 g/mol. Its IUPAC name is [4-[2-(1,3-thiazol-2-yl)imidazo[1,2-a]pyridin-6-yl]thiophen-2-yl]methanol.
Molecular Properties
| Compound Name | [4-[2-(1,3-thiazol-2-yl)imidazo[1,2-a]pyridin-6-yl]thiophen-2-yl]methanol |
| PubChem CID | 66624721 |
| Molecular Formula | C15H11N3OS2 |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | [4-[2-(1,3-thiazol-2-yl)imidazo[1,2-a]pyridin-6-yl]thiophen-2-yl]methanol |
| SMILES | OCc1cc(-c2ccc3nc(-c4nccs4)cn3c2)cs1 |
| InChI | InChI=1S/C15H11N3OS2/c19-8-12-5-11(9-21-12)10-1-2-14-17-13(7-18(14)6-10)15-16-3-4-20-15/h1-7,9,19H,8H2 |
| InChIKey | ZDNKWLJTRJUQDU-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-[2-(1,3-thiazol-2-yl)imidazo[1,2-a]pyridin-6-yl]thiophen-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-(1,3-thiazol-2-yl)imidazo[1,2-a]pyridin-6-yl]thiophen-2-yl]methanol?
The IUPAC name of [4-[2-(1,3-thiazol-2-yl)imidazo[1,2-a]pyridin-6-yl]thiophen-2-yl]methanol (CID 66624721) is [4-[2-(1,3-thiazol-2-yl)imidazo[1,2-a]pyridin-6-yl]thiophen-2-yl]methanol.
What is the SMILES notation for [4-[2-(1,3-thiazol-2-yl)imidazo[1,2-a]pyridin-6-yl]thiophen-2-yl]methanol?
The canonical SMILES for [4-[2-(1,3-thiazol-2-yl)imidazo[1,2-a]pyridin-6-yl]thiophen-2-yl]methanol is OCc1cc(-c2ccc3nc(-c4nccs4)cn3c2)cs1.
What is the InChIKey of [4-[2-(1,3-thiazol-2-yl)imidazo[1,2-a]pyridin-6-yl]thiophen-2-yl]methanol?
The InChIKey is ZDNKWLJTRJUQDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N3OS2/c19-8-12-5-11(9-21-12)10-1-2-14-17-13(7-18(14)6-10)15-16-3-4-20-15/h1-7,9,19H,8H2.
What are the key properties of [4-[2-(1,3-thiazol-2-yl)imidazo[1,2-a]pyridin-6-yl]thiophen-2-yl]methanol?
[4-[2-(1,3-thiazol-2-yl)imidazo[1,2-a]pyridin-6-yl]thiophen-2-yl]methanol has a molecular weight of 313.41 g/mol, XLogP of 3.68, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-(1,3-thiazol-2-yl)imidazo[1,2-a]pyridin-6-yl]thiophen-2-yl]methanol is sourced from PubChem (CID 66624721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).