C14H25N — CID 66624953
1-ethyl-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-carbazole (PubChem CID 66624953) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is 1-ethyl-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-carbazole.
| Compound Name | 1-ethyl-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-carbazole |
|---|---|
| PubChem CID | 66624953 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | 1-ethyl-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-carbazole |
| SMILES | CCC1CCCC2C3CCCCC3NC12 |
| InChI | InChI=1S/C14H25N/c1-2-10-6-5-8-12-11-7-3-4-9-13(11)15-14(10)12/h10-15H,2-9H2,1H3 |
| InChIKey | RTEYFMRFIQXVMH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |