C23H29F3N3O4+ — CID 66625133
N-[2-methyl-4-[1-[(2S)-2-methylpyrrolidin-1-yl]pyrrolidin-1-ium-1-yl]phenyl]furan-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 66625133) has the molecular formula C23H29F3N3O4+ and a molecular weight of 468.50 g/mol. Its IUPAC name is N-[2-methyl-4-[1-[(2S)-2-methylpyrrolidin-1-yl]pyrrolidin-1-ium-1-yl]phenyl]furan-3-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[2-methyl-4-[1-[(2S)-2-methylpyrrolidin-1-yl]pyrrolidin-1-ium-1-yl]phenyl]furan-3-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 66625133 |
| Molecular Formula | C23H29F3N3O4+ |
| Molecular Weight | 468.50 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | N-[2-methyl-4-[1-[(2S)-2-methylpyrrolidin-1-yl]pyrrolidin-1-ium-1-yl]phenyl]furan-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc([N+]2(N3CCC[C@@H]3C)CCCC2)ccc1NC(=O)c1ccoc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H27N3O2.C2HF3O2/c1-16-14-19(7-8-20(16)22-21(25)18-9-13-26-15-18)24(11-3-4-12-24)23-10-5-6-17(23)2;3-2(4,5)1(6)7/h7-9,13-15,17H,3-6,10-12H2,1-2H3;(H,6,7)/p+1/t17-;/m0./s1 |
| InChIKey | BGDOYUJOHKJLDN-LMOVPXPDSA-O |
| XLogP | 4.97 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.50 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|