C27H32Cl2N2O3 — CID 66625211
tert-butyl (2'R,3R,3'S,5'S)-6-chloro-3'-(3-chlorophenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxylate (PubChem CID 66625211) has the molecular formula C27H32Cl2N2O3 and a molecular weight of 503.47 g/mol. Its IUPAC name is tert-butyl (2'R,3R,3'S,5'S)-6-chloro-3'-(3-chlorophenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxylate.
| Compound Name | tert-butyl (2'R,3R,3'S,5'S)-6-chloro-3'-(3-chlorophenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxylate |
|---|---|
| PubChem CID | 66625211 |
| Molecular Formula | C27H32Cl2N2O3 |
| Molecular Weight | 503.47 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | tert-butyl (2'R,3R,3'S,5'S)-6-chloro-3'-(3-chlorophenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxylate |
| SMILES | CC(C)(C)C[C@@H]1N[C@@H](C(=O)OC(C)(C)C)[C@@H](c2cccc(Cl)c2)[C@]12C(=O)Nc1cc(Cl)ccc12 |
| InChI | InChI=1S/C27H32Cl2N2O3/c1-25(2,3)14-20-27(18-11-10-17(29)13-19(18)30-24(27)33)21(15-8-7-9-16(28)12-15)22(31-20)23(32)34-26(4,5)6/h7-13,20-22,31H,14H2,1-6H3,(H,30,33)/t20-,21+,22+,27+/m0/s1 |
| InChIKey | RIARBXGTURECMZ-HRGDABNKSA-N |
| XLogP | 6.09 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.47 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |