C21H25N7O6 — CID 66625918
(2S)-2-amino-3-(1H-indol-3-yl)propanoic acid;(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 66625918) has the molecular formula C21H25N7O6 and a molecular weight of 471.47 g/mol. Its IUPAC name is (2S)-2-amino-3-(1H-indol-3-yl)propanoic acid;(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2S)-2-amino-3-(1H-indol-3-yl)propanoic acid;(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 66625918 |
| Molecular Formula | C21H25N7O6 |
| Molecular Weight | 471.47 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | (2S)-2-amino-3-(1H-indol-3-yl)propanoic acid;(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O.Nc1ncnc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C11H12N2O2.C10H13N5O4/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10;11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10/h1-4,6,9,13H,5,12H2,(H,14,15);2-4,6-7,10,16-18H,1H2,(H2,11,12,13)/t9-;4-,6-,7-,10-/m01/s1 |
| InChIKey | UMLAAJXRIBWXBL-IEMOAEIGSA-N |
| XLogP | -0.86 |
| TPSA | 218.65 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.47 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |