C13H21ClN3O3S+ — CID 66625981
7-chloro-3-methyl-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide;2-hydroxyethyl(trimethyl)azanium (PubChem CID 66625981) has the molecular formula C13H21ClN3O3S+ and a molecular weight of 334.85 g/mol. Its IUPAC name is 7-chloro-3-methyl-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide;2-hydroxyethyl(trimethyl)azanium.
| Compound Name | 7-chloro-3-methyl-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide;2-hydroxyethyl(trimethyl)azanium |
|---|---|
| PubChem CID | 66625981 |
| Molecular Formula | C13H21ClN3O3S+ |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 7-chloro-3-methyl-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide;2-hydroxyethyl(trimethyl)azanium |
| SMILES | CC1=NS(=O)(=O)c2cc(Cl)ccc2N1.C[N+](C)(C)CCO |
| InChI | InChI=1S/C8H7ClN2O2S.C5H14NO/c1-5-10-7-3-2-6(9)4-8(7)14(12,13)11-5;1-6(2,3)4-5-7/h2-4H,1H3,(H,10,11);7H,4-5H2,1-3H3/q;+1 |
| InChIKey | HDPYPMDYNYTKHI-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|