C23H29NO4 — CID 66626163
[6-(2-amino-4,5-dimethoxyphenyl)-5,6,7,8-tetrahydronaphthalen-2-yl] 2,2-dimethylpropanoate (PubChem CID 66626163) has the molecular formula C23H29NO4 and a molecular weight of 383.49 g/mol. Its IUPAC name is [6-(2-amino-4,5-dimethoxyphenyl)-5,6,7,8-tetrahydronaphthalen-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [6-(2-amino-4,5-dimethoxyphenyl)-5,6,7,8-tetrahydronaphthalen-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 66626163 |
| Molecular Formula | C23H29NO4 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | [6-(2-amino-4,5-dimethoxyphenyl)-5,6,7,8-tetrahydronaphthalen-2-yl] 2,2-dimethylpropanoate |
| SMILES | COc1cc(N)c(C2CCc3cc(OC(=O)C(C)(C)C)ccc3C2)cc1OC |
| InChI | InChI=1S/C23H29NO4/c1-23(2,3)22(25)28-17-9-8-14-10-16(7-6-15(14)11-17)18-12-20(26-4)21(27-5)13-19(18)24/h8-9,11-13,16H,6-7,10,24H2,1-5H3 |
| InChIKey | VSQIAUYBUVZILT-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|